About N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide
N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide (PubChem CID 159881532) has the molecular formula C18H15FN2O3S
and a molecular weight of 358.39 g/mol. Its IUPAC name is N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide.
Molecular Properties
| Compound Name | N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide |
| PubChem CID | 159881532 |
| Molecular Formula | C18H15FN2O3S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide |
| SMILES | Cc1nc(-c2ccc(C(=O)N=S(C)(=O)c3ccccc3F)cc2)co1 |
| InChI | InChI=1S/C18H15FN2O3S/c1-12-20-16(11-24-12)13-7-9-14(10-8-13)18(22)21-25(2,23)17-6-4-3-5-15(17)19/h3-11H,1-2H3 |
| InChIKey | NTOVRLSXHDJSPN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide?
The IUPAC name of N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide (CID 159881532) is N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide.
What is the SMILES notation for N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide?
The canonical SMILES for N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide is Cc1nc(-c2ccc(C(=O)N=S(C)(=O)c3ccccc3F)cc2)co1.
What is the InChIKey of N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide?
The InChIKey is NTOVRLSXHDJSPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2O3S/c1-12-20-16(11-24-12)13-7-9-14(10-8-13)18(22)21-25(2,23)17-6-4-3-5-15(17)19/h3-11H,1-2H3.
What are the key properties of N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide?
N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide has a molecular weight of 358.39 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]-4-(2-methyl-1,3-oxazol-4-yl)benzamide is sourced from PubChem (CID 159881532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).