C22H33N5O2S — CID 15988157
N-(2-ethylhexyl)-4-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide (PubChem CID 15988157) has the molecular formula C22H33N5O2S and a molecular weight of 431.61 g/mol. Its IUPAC name is N-(2-ethylhexyl)-4-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide.
| Compound Name | N-(2-ethylhexyl)-4-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide |
|---|---|
| PubChem CID | 15988157 |
| Molecular Formula | C22H33N5O2S |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | N-(2-ethylhexyl)-4-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide |
| SMILES | CCCCC(CC)CNC(=O)CCCc1nnc2n(CCC)c(=O)c3sccc3n12 |
| InChI | InChI=1S/C22H33N5O2S/c1-4-7-9-16(6-3)15-23-19(28)11-8-10-18-24-25-22-26(13-5-2)21(29)20-17(27(18)22)12-14-30-20/h12,14,16H,4-11,13,15H2,1-3H3,(H,23,28) |
| InChIKey | NGSQGIDENRAWQY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |