About methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one
methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 159881955) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one.
Molecular Properties
| Compound Name | methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one |
| PubChem CID | 159881955 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | CO.O=C1OCC2C3CCC(C3)C12 |
| InChI | InChI=1S/C9H12O2.CH4O/c10-9-8-6-2-1-5(3-6)7(8)4-11-9;1-2/h5-8H,1-4H2;2H,1H3 |
| InChIKey | NTQCXCUULWYMLO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one?
The IUPAC name of methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one (CID 159881955) is methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one.
What is the SMILES notation for methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one?
The canonical SMILES for methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one is CO.O=C1OCC2C3CCC(C3)C12.
What is the InChIKey of methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one?
The InChIKey is NTQCXCUULWYMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.CH4O/c10-9-8-6-2-1-5(3-6)7(8)4-11-9;1-2/h5-8H,1-4H2;2H,1H3.
What are the key properties of methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one?
methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one has a molecular weight of 184.23 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;4-oxatricyclo[5.2.1.02,6]decan-3-one is sourced from PubChem (CID 159881955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).