C24H29N3O — CID 159882608
N-methyl-N-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 159882608) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-methyl-N-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | N-methyl-N-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 159882608 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-methyl-N-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cccc(CN2CCC(CN(C)C(=O)c3cc4ccccc4[nH]3)CC2)c1 |
| InChI | InChI=1S/C24H29N3O/c1-18-6-5-7-20(14-18)17-27-12-10-19(11-13-27)16-26(2)24(28)23-15-21-8-3-4-9-22(21)25-23/h3-9,14-15,19,25H,10-13,16-17H2,1-2H3 |
| InChIKey | JVKWDUZJFKYQBM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |