C19H19N5O2S — CID 15988329
3-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[(4-methylphenyl)methyl]propanamide (PubChem CID 15988329) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[(4-methylphenyl)methyl]propanamide.
| Compound Name | 3-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[(4-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 15988329 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[(4-methylphenyl)methyl]propanamide |
| SMILES | Cc1ccc(CNC(=O)CCc2nnc3n(C)c(=O)c4sccc4n23)cc1 |
| InChI | InChI=1S/C19H19N5O2S/c1-12-3-5-13(6-4-12)11-20-16(25)8-7-15-21-22-19-23(2)18(26)17-14(24(15)19)9-10-27-17/h3-6,9-10H,7-8,11H2,1-2H3,(H,20,25) |
| InChIKey | YJWUGLPUUSPILT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |