C37H32FN9O8 — CID 159883414
2,4-dinitro-N,N-bis(pyridin-2-ylmethyl)aniline;1-fluoro-2,4-dinitrobenzene;2-(3-pyridin-2-ylpropyl)pyridine (PubChem CID 159883414) has the molecular formula C37H32FN9O8 and a molecular weight of 749.72 g/mol. Its IUPAC name is 2,4-dinitro-N,N-bis(pyridin-2-ylmethyl)aniline;1-fluoro-2,4-dinitrobenzene;2-(3-pyridin-2-ylpropyl)pyridine.
| Compound Name | 2,4-dinitro-N,N-bis(pyridin-2-ylmethyl)aniline;1-fluoro-2,4-dinitrobenzene;2-(3-pyridin-2-ylpropyl)pyridine |
|---|---|
| PubChem CID | 159883414 |
| Molecular Formula | C37H32FN9O8 |
| Molecular Weight | 749.72 g/mol |
| Exact Mass | 749.24 |
| IUPAC Name | 2,4-dinitro-N,N-bis(pyridin-2-ylmethyl)aniline;1-fluoro-2,4-dinitrobenzene;2-(3-pyridin-2-ylpropyl)pyridine |
| SMILES | O=[N+]([O-])c1ccc(F)c([N+](=O)[O-])c1.O=[N+]([O-])c1ccc(N(Cc2ccccn2)Cc2ccccn2)c([N+](=O)[O-])c1.c1ccc(CCCc2ccccn2)nc1 |
| InChI | InChI=1S/C18H15N5O4.C13H14N2.C6H3FN2O4/c24-22(25)16-7-8-17(18(11-16)23(26)27)21(12-14-5-1-3-9-19-14)13-15-6-2-4-10-20-15;1-3-10-14-12(6-1)8-5-9-13-7-2-4-11-15-13;7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-11H,12-13H2;1-4,6-7,10-11H,5,8-9H2;1-3H |
| InChIKey | NTVAUINDKJOFEK-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 227.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.72 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|