C40H44F6N6O4 — CID 159883482
N-[3-[[3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 159883482) has the molecular formula C40H44F6N6O4 and a molecular weight of 786.82 g/mol. Its IUPAC name is N-[3-[[3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[3-[[3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 159883482 |
| Molecular Formula | C40H44F6N6O4 |
| Molecular Weight | 786.82 g/mol |
| Exact Mass | 786.33 |
| IUPAC Name | N-[3-[[3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(NC2CC(Oc3ncccc3C3CCOCC3)C2)nc1.FC(F)(F)c1ccc(NC2CC(Oc3ncccc3C3CCOCC3)C2)nc1 |
| InChI | InChI=1S/2C20H22F3N3O2/c2*21-20(22,23)14-3-4-18(25-12-14)26-15-10-16(11-15)28-19-17(2-1-7-24-19)13-5-8-27-9-6-13/h2*1-4,7,12-13,15-16H,5-6,8-11H2,(H,25,26) |
| InChIKey | NTVHLXXIUSKZOD-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.82 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |