About methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide
methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide (PubChem CID 159883686) has the molecular formula C20H23N3O
and a molecular weight of 321.42 g/mol. Its IUPAC name is methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide.
Molecular Properties
| Compound Name | methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide |
| PubChem CID | 159883686 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide |
| SMILES | C.C=CC(=O)/N=C1\N=C2C=CC(C(C)C)=CN2Cc2ccccc21 |
| InChI | InChI=1S/C19H19N3O.CH4/c1-4-18(23)21-19-16-8-6-5-7-15(16)12-22-11-14(13(2)3)9-10-17(22)20-19;/h4-11,13H,1,12H2,2-3H3;1H4/b21-19-; |
| InChIKey | NTVZVYINHQBUBB-WQGAEACMSA-N |
| XLogP | 4.11 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide?
The IUPAC name of methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide (CID 159883686) is methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide.
What is the SMILES notation for methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide?
The canonical SMILES for methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide is C.C=CC(=O)/N=C1\N=C2C=CC(C(C)C)=CN2Cc2ccccc21.
What is the InChIKey of methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide?
The InChIKey is NTVZVYINHQBUBB-WQGAEACMSA-N. The full InChI is InChI=1S/C19H19N3O.CH4/c1-4-18(23)21-19-16-8-6-5-7-15(16)12-22-11-14(13(2)3)9-10-17(22)20-19;/h4-11,13H,1,12H2,2-3H3;1H4/b21-19-;.
What are the key properties of methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide?
methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide has a molecular weight of 321.42 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N-(2-propan-2-yl-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)prop-2-enamide is sourced from PubChem (CID 159883686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).