C46H38F6N8O6 — CID 159884503
2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(pyridin-3-ylamino)propan-2-ol (PubChem CID 159884503) has the molecular formula C46H38F6N8O6 and a molecular weight of 912.85 g/mol. Its IUPAC name is 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(pyridin-3-ylamino)propan-2-ol.
| Compound Name | 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(pyridin-3-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 159884503 |
| Molecular Formula | C46H38F6N8O6 |
| Molecular Weight | 912.85 g/mol |
| Exact Mass | 912.28 |
| IUPAC Name | 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(pyridin-3-ylamino)propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc2c(C(O)(CNc3cccnc3)C(F)(F)F)cn(Cc3ccccc3)c2c1.O=[N+]([O-])c1ccc2c(C(O)(CNc3cccnc3)C(F)(F)F)cn(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/2C23H19F3N4O3/c2*24-23(25,26)22(31,15-28-17-7-4-10-27-12-17)20-14-29(13-16-5-2-1-3-6-16)21-11-18(30(32)33)8-9-19(20)21/h2*1-12,14,28,31H,13,15H2 |
| InChIKey | NTYNHKSAWVMMMO-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 186.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.85 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|