About furo[2,3-b]furan;thieno[3,2-b]thiophene
furo[2,3-b]furan;thieno[3,2-b]thiophene (PubChem CID 159884631) has the molecular formula C12H8O2S2
and a molecular weight of 248.33 g/mol. Its IUPAC name is furo[2,3-b]furan;thieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | furo[2,3-b]furan;thieno[3,2-b]thiophene |
| PubChem CID | 159884631 |
| Molecular Formula | C12H8O2S2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | furo[2,3-b]furan;thieno[3,2-b]thiophene |
| SMILES | c1cc2ccoc2o1.c1cc2sccc2s1 |
| InChI | InChI=1S/C6H4O2.C6H4S2/c1-3-7-6-5(1)2-4-8-6;1-3-7-6-2-4-8-5(1)6/h2*1-4H |
| InChIKey | NTYWNKANSFIZEW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze furo[2,3-b]furan;thieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[2,3-b]furan;thieno[3,2-b]thiophene?
The IUPAC name of furo[2,3-b]furan;thieno[3,2-b]thiophene (CID 159884631) is furo[2,3-b]furan;thieno[3,2-b]thiophene.
What is the SMILES notation for furo[2,3-b]furan;thieno[3,2-b]thiophene?
The canonical SMILES for furo[2,3-b]furan;thieno[3,2-b]thiophene is c1cc2ccoc2o1.c1cc2sccc2s1.
What is the InChIKey of furo[2,3-b]furan;thieno[3,2-b]thiophene?
The InChIKey is NTYWNKANSFIZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2.C6H4S2/c1-3-7-6-5(1)2-4-8-6;1-3-7-6-2-4-8-5(1)6/h2*1-4H.
What are the key properties of furo[2,3-b]furan;thieno[3,2-b]thiophene?
furo[2,3-b]furan;thieno[3,2-b]thiophene has a molecular weight of 248.33 g/mol, XLogP of 4.99, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furo[2,3-b]furan;thieno[3,2-b]thiophene is sourced from PubChem (CID 159884631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).