C24H16Cl2N2O2S — CID 15988485
3-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-7-phenyl-1,6,7,8-tetrahydroquinoline-2,5-dione (PubChem CID 15988485) has the molecular formula C24H16Cl2N2O2S and a molecular weight of 467.38 g/mol. Its IUPAC name is 3-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-7-phenyl-1,6,7,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 3-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-7-phenyl-1,6,7,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 15988485 |
| Molecular Formula | C24H16Cl2N2O2S |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 3-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-7-phenyl-1,6,7,8-tetrahydroquinoline-2,5-dione |
| SMILES | O=C1CC(c2ccccc2)Cc2[nH]c(=O)c(-c3nc(-c4ccc(Cl)c(Cl)c4)cs3)cc21 |
| InChI | InChI=1S/C24H16Cl2N2O2S/c25-18-7-6-14(8-19(18)26)21-12-31-24(28-21)17-11-16-20(27-23(17)30)9-15(10-22(16)29)13-4-2-1-3-5-13/h1-8,11-12,15H,9-10H2,(H,27,30) |
| InChIKey | AGKAKCYHHBTWTK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |