C14H21F8NO — CID 159885104
1-[3,3-difluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]azepane (PubChem CID 159885104) has the molecular formula C14H21F8NO and a molecular weight of 371.31 g/mol. Its IUPAC name is 1-[3,3-difluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]azepane.
| Compound Name | 1-[3,3-difluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]azepane |
|---|---|
| PubChem CID | 159885104 |
| Molecular Formula | C14H21F8NO |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[3,3-difluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]azepane |
| SMILES | CC(N1CCCCCC1)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C14H21F8NO/c1-10(23-6-4-2-3-5-7-23)12(16,17)8-24-9-13(18,19)11(15)14(20,21)22/h10-11H,2-9H2,1H3 |
| InChIKey | QERFGLCEYQSIQQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |