C18H22N6O — CID 159885303
(4S)-4,8-dimethyl-5-(pyridin-4-ylmethyl)-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-12,14-dien-7-one (PubChem CID 159885303) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is (4S)-4,8-dimethyl-5-(pyridin-4-ylmethyl)-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-12,14-dien-7-one.
| Compound Name | (4S)-4,8-dimethyl-5-(pyridin-4-ylmethyl)-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-12,14-dien-7-one |
|---|---|
| PubChem CID | 159885303 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (4S)-4,8-dimethyl-5-(pyridin-4-ylmethyl)-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-12,14-dien-7-one |
| SMILES | C[C@H]1NC2C(C(=O)N(C)C3NC4C=CC=C4N23)N1Cc1ccncc1 |
| InChI | InChI=1S/C18H22N6O/c1-11-20-16-15(23(11)10-12-6-8-19-9-7-12)17(25)22(2)18-21-13-4-3-5-14(13)24(16)18/h3-9,11,13,15-16,18,20-21H,10H2,1-2H3/t11-,13?,15?,16?,18?/m0/s1 |
| InChIKey | NUBDLRGGGIDRCR-KOGDIJHLSA-N |
| XLogP | 0.01 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |