About adamantane;ethane;ethene
adamantane;ethane;ethene (PubChem CID 159885768) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is adamantane;ethane;ethene.
Molecular Properties
| Compound Name | adamantane;ethane;ethene |
| PubChem CID | 159885768 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | adamantane;ethane;ethene |
| SMILES | C1C2CC3CC1CC(C2)C3.C=C.CC |
| InChI | InChI=1S/C10H16.C2H6.C2H4/c1-7-2-9-4-8(1)5-10(3-7)6-9;2*1-2/h7-10H,1-6H2;1-2H3;1-2H2 |
| InChIKey | NUCQNSOHDQIZBO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze adamantane;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;ethane;ethene?
The IUPAC name of adamantane;ethane;ethene (CID 159885768) is adamantane;ethane;ethene.
What is the SMILES notation for adamantane;ethane;ethene?
The canonical SMILES for adamantane;ethane;ethene is C1C2CC3CC1CC(C2)C3.C=C.CC.
What is the InChIKey of adamantane;ethane;ethene?
The InChIKey is NUCQNSOHDQIZBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C2H6.C2H4/c1-7-2-9-4-8(1)5-10(3-7)6-9;2*1-2/h7-10H,1-6H2;1-2H3;1-2H2.
What are the key properties of adamantane;ethane;ethene?
adamantane;ethane;ethene has a molecular weight of 194.36 g/mol, XLogP of 4.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;ethane;ethene is sourced from PubChem (CID 159885768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).