About N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene
N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene (PubChem CID 159885987) has the molecular formula C16H29NO
and a molecular weight of 251.41 g/mol. Its IUPAC name is N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene.
Molecular Properties
| Compound Name | N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene |
| PubChem CID | 159885987 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene |
| SMILES | CC(C)(C)Oc1ccccc1.CCNC(C)(C)C |
| InChI | InChI=1S/C10H14O.C6H15N/c1-10(2,3)11-9-7-5-4-6-8-9;1-5-7-6(2,3)4/h4-8H,1-3H3;7H,5H2,1-4H3 |
| InChIKey | NUDILKWKRGFEID-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene?
The IUPAC name of N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene (CID 159885987) is N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene.
What is the SMILES notation for N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene?
The canonical SMILES for N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene is CC(C)(C)Oc1ccccc1.CCNC(C)(C)C.
What is the InChIKey of N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene?
The InChIKey is NUDILKWKRGFEID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C6H15N/c1-10(2,3)11-9-7-5-4-6-8-9;1-5-7-6(2,3)4/h4-8H,1-3H3;7H,5H2,1-4H3.
What are the key properties of N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene?
N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene has a molecular weight of 251.41 g/mol, XLogP of 4.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methylpropan-2-amine;(2-methylpropan-2-yl)oxybenzene is sourced from PubChem (CID 159885987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).