C32H25N3O5S — CID 15988632
7-(4-methoxyphenyl)-1-(2-methylphenyl)-3-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-7,8-dihydro-6H-quinoline-2,5-dione (PubChem CID 15988632) has the molecular formula C32H25N3O5S and a molecular weight of 563.64 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-1-(2-methylphenyl)-3-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-7,8-dihydro-6H-quinoline-2,5-dione.
| Compound Name | 7-(4-methoxyphenyl)-1-(2-methylphenyl)-3-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-7,8-dihydro-6H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 15988632 |
| Molecular Formula | C32H25N3O5S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 7-(4-methoxyphenyl)-1-(2-methylphenyl)-3-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-7,8-dihydro-6H-quinoline-2,5-dione |
| SMILES | COc1ccc(C2CC(=O)c3cc(-c4nc(-c5cccc([N+](=O)[O-])c5)cs4)c(=O)n(-c4ccccc4C)c3C2)cc1 |
| InChI | InChI=1S/C32H25N3O5S/c1-19-6-3-4-9-28(19)34-29-15-22(20-10-12-24(40-2)13-11-20)16-30(36)25(29)17-26(32(34)37)31-33-27(18-41-31)21-7-5-8-23(14-21)35(38)39/h3-14,17-18,22H,15-16H2,1-2H3 |
| InChIKey | MTFWHXCATQYTSN-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|