C17H17F3N2O4S2 — CID 15988672
1-thiophen-2-ylsulfonyl-N-[4-(trifluoromethoxy)phenyl]piperidine-4-carboxamide (PubChem CID 15988672) has the molecular formula C17H17F3N2O4S2 and a molecular weight of 434.46 g/mol. Its IUPAC name is 1-thiophen-2-ylsulfonyl-N-[4-(trifluoromethoxy)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-thiophen-2-ylsulfonyl-N-[4-(trifluoromethoxy)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 15988672 |
| Molecular Formula | C17H17F3N2O4S2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 1-thiophen-2-ylsulfonyl-N-[4-(trifluoromethoxy)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H17F3N2O4S2/c18-17(19,20)26-14-5-3-13(4-6-14)21-16(23)12-7-9-22(10-8-12)28(24,25)15-2-1-11-27-15/h1-6,11-12H,7-10H2,(H,21,23) |
| InChIKey | JXJRJZAWVYIILO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |