C11H16F8N2 — CID 159886834
1-ethyl-3-(2,2,3,3,4,4,5,5-octafluoropentyl)-2H-imidazole;methane (PubChem CID 159886834) has the molecular formula C11H16F8N2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 1-ethyl-3-(2,2,3,3,4,4,5,5-octafluoropentyl)-2H-imidazole;methane.
| Compound Name | 1-ethyl-3-(2,2,3,3,4,4,5,5-octafluoropentyl)-2H-imidazole;methane |
|---|---|
| PubChem CID | 159886834 |
| Molecular Formula | C11H16F8N2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-ethyl-3-(2,2,3,3,4,4,5,5-octafluoropentyl)-2H-imidazole;methane |
| SMILES | C.CCN1C=CN(CC(F)(F)C(F)(F)C(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C10H12F8N2.CH4/c1-2-19-3-4-20(6-19)5-8(13,14)10(17,18)9(15,16)7(11)12;/h3-4,7H,2,5-6H2,1H3;1H4 |
| InChIKey | NUFXLDGJDIUCQF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|