C19H24Cl3N5O — CID 159886893
2-(3-aminopropyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one;3-chloro-N,N-bis(2-chloroethyl)aniline (PubChem CID 159886893) has the molecular formula C19H24Cl3N5O and a molecular weight of 444.79 g/mol. Its IUPAC name is 2-(3-aminopropyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one;3-chloro-N,N-bis(2-chloroethyl)aniline.
| Compound Name | 2-(3-aminopropyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one;3-chloro-N,N-bis(2-chloroethyl)aniline |
|---|---|
| PubChem CID | 159886893 |
| Molecular Formula | C19H24Cl3N5O |
| Molecular Weight | 444.79 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-(3-aminopropyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one;3-chloro-N,N-bis(2-chloroethyl)aniline |
| SMILES | ClCCN(CCCl)c1cccc(Cl)c1.NCCCn1nc2ccccn2c1=O |
| InChI | InChI=1S/C10H12Cl3N.C9H12N4O/c11-4-6-14(7-5-12)10-3-1-2-9(13)8-10;10-5-3-7-13-9(14)12-6-2-1-4-8(12)11-13/h1-3,8H,4-7H2;1-2,4,6H,3,5,7,10H2 |
| InChIKey | NUGCWFZQFHYSMS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 68.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.79 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|