About N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide
N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide (PubChem CID 15988740) has the molecular formula C22H22N2O6S2
and a molecular weight of 474.56 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide.
Molecular Properties
| Compound Name | N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide |
| PubChem CID | 15988740 |
| Molecular Formula | C22H22N2O6S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NC(=O)CCS(=O)(=O)c3cccs3)cc2)cc1OC |
| InChI | InChI=1S/C22H22N2O6S2/c1-29-18-10-9-17(14-19(18)30-2)24-22(26)15-5-7-16(8-6-15)23-20(25)11-13-32(27,28)21-4-3-12-31-21/h3-10,12,14H,11,13H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | VUYYULCMSVGRFC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide?
The IUPAC name of N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide (CID 15988740) is N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide.
What is the SMILES notation for N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide?
The canonical SMILES for N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide is COc1ccc(NC(=O)c2ccc(NC(=O)CCS(=O)(=O)c3cccs3)cc2)cc1OC.
What is the InChIKey of N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide?
The InChIKey is VUYYULCMSVGRFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O6S2/c1-29-18-10-9-17(14-19(18)30-2)24-22(26)15-5-7-16(8-6-15)23-20(25)11-13-32(27,28)21-4-3-12-31-21/h3-10,12,14H,11,13H2,1-2H3,(H,23,25)(H,24,26).
What are the key properties of N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide?
N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide has a molecular weight of 474.56 g/mol, XLogP of 3.82, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethoxyphenyl)-4-(3-thiophen-2-ylsulfonylpropanoylamino)benzamide is sourced from PubChem (CID 15988740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).