About (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile
(2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile (PubChem CID 159887703) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile.
Molecular Properties
| Compound Name | (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile |
| PubChem CID | 159887703 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCO1.N#C[C@H]1CCCO1 |
| InChI | InChI=1S/2C5H7NO/c2*6-4-5-2-1-3-7-5/h2*5H,1-3H2/t2*5-/m10/s1 |
| InChIKey | NUIPLVFZTBZEFB-JZLFTLSWSA-N |
| XLogP | 1.38 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile?
The IUPAC name of (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile (CID 159887703) is (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile.
What is the SMILES notation for (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile?
The canonical SMILES for (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile is N#C[C@@H]1CCCO1.N#C[C@H]1CCCO1.
What is the InChIKey of (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile?
The InChIKey is NUIPLVFZTBZEFB-JZLFTLSWSA-N. The full InChI is InChI=1S/2C5H7NO/c2*6-4-5-2-1-3-7-5/h2*5H,1-3H2/t2*5-/m10/s1.
What are the key properties of (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile?
(2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile has a molecular weight of 194.23 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-oxolane-2-carbonitrile;(2R)-oxolane-2-carbonitrile is sourced from PubChem (CID 159887703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).