About N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide
N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide (PubChem CID 15988788) has the molecular formula C20H24N4O2
and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 15988788 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCc1cc(C(=O)Nc2c(C)nn(Cc3ccc(C)cc3)c2C)no1 |
| InChI | InChI=1S/C20H24N4O2/c1-5-6-17-11-18(23-26-17)20(25)21-19-14(3)22-24(15(19)4)12-16-9-7-13(2)8-10-16/h7-11H,5-6,12H2,1-4H3,(H,21,25) |
| InChIKey | FKFSFVPVMXCBLP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide (CID 15988788) is N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide is CCCc1cc(C(=O)Nc2c(C)nn(Cc3ccc(C)cc3)c2C)no1.
What is the InChIKey of N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide?
The InChIKey is FKFSFVPVMXCBLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O2/c1-5-6-17-11-18(23-26-17)20(25)21-19-14(3)22-24(15(19)4)12-16-9-7-13(2)8-10-16/h7-11H,5-6,12H2,1-4H3,(H,21,25).
What are the key properties of N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide?
N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide has a molecular weight of 352.44 g/mol, XLogP of 4.05, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-propyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 15988788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).