About ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate
ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 15988806) has the molecular formula C23H17FN2O4S
and a molecular weight of 436.46 g/mol. Its IUPAC name is ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
| PubChem CID | 15988806 |
| Molecular Formula | C23H17FN2O4S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1cc(-c2ccc(F)cc2)on1 |
| InChI | InChI=1S/C23H17FN2O4S/c1-2-29-23(28)20-17(14-6-4-3-5-7-14)13-31-22(20)25-21(27)18-12-19(30-26-18)15-8-10-16(24)11-9-15/h3-13H,2H2,1H3,(H,25,27) |
| InChIKey | IOFQNSWBKPWVEY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate?
The IUPAC name of ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate (CID 15988806) is ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate.
What is the SMILES notation for ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate?
The canonical SMILES for ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate is CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1cc(-c2ccc(F)cc2)on1.
What is the InChIKey of ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate?
The InChIKey is IOFQNSWBKPWVEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17FN2O4S/c1-2-29-23(28)20-17(14-6-4-3-5-7-14)13-31-22(20)25-21(27)18-12-19(30-26-18)15-8-10-16(24)11-9-15/h3-13H,2H2,1H3,(H,25,27).
What are the key properties of ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate?
ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate has a molecular weight of 436.46 g/mol, XLogP of 5.64, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate is sourced from PubChem (CID 15988806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).