About N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine
N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 15988948) has the molecular formula C21H21N3S2
and a molecular weight of 379.55 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine.
Molecular Properties
| Compound Name | N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine |
| PubChem CID | 15988948 |
| Molecular Formula | C21H21N3S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | CCc1cccc(C)c1Nc1c(-c2ccc(SC)cc2)nc2sccn12 |
| InChI | InChI=1S/C21H21N3S2/c1-4-15-7-5-6-14(2)18(15)22-20-19(23-21-24(20)12-13-26-21)16-8-10-17(25-3)11-9-16/h5-13,22H,4H2,1-3H3 |
| InChIKey | XQQFKRMBVYEUCE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine?
The IUPAC name of N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine (CID 15988948) is N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine.
What is the SMILES notation for N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine?
The canonical SMILES for N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine is CCc1cccc(C)c1Nc1c(-c2ccc(SC)cc2)nc2sccn12.
What is the InChIKey of N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine?
The InChIKey is XQQFKRMBVYEUCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3S2/c1-4-15-7-5-6-14(2)18(15)22-20-19(23-21-24(20)12-13-26-21)16-8-10-17(25-3)11-9-16/h5-13,22H,4H2,1-3H3.
What are the key properties of N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine?
N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine has a molecular weight of 379.55 g/mol, XLogP of 6.40, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethyl-6-methylphenyl)-6-(4-methylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine is sourced from PubChem (CID 15988948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).