C15H12F3N5O3 — CID 15988965
2,2,2-trifluoro-N-(1,3,9-trimethyl-2,4-dioxobenzo[g]pteridin-8-yl)acetamide (PubChem CID 15988965) has the molecular formula C15H12F3N5O3 and a molecular weight of 367.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(1,3,9-trimethyl-2,4-dioxobenzo[g]pteridin-8-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(1,3,9-trimethyl-2,4-dioxobenzo[g]pteridin-8-yl)acetamide |
|---|---|
| PubChem CID | 15988965 |
| Molecular Formula | C15H12F3N5O3 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2,2,2-trifluoro-N-(1,3,9-trimethyl-2,4-dioxobenzo[g]pteridin-8-yl)acetamide |
| SMILES | Cc1c(NC(=O)C(F)(F)F)ccc2nc3c(=O)n(C)c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C15H12F3N5O3/c1-6-7(20-13(25)15(16,17)18)4-5-8-9(6)21-11-10(19-8)12(24)23(3)14(26)22(11)2/h4-5H,1-3H3,(H,20,25) |
| InChIKey | FWQUOOZXXFIIDJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|