About N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine
N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine (PubChem CID 159889830) has the molecular formula C7H18N2O2
and a molecular weight of 162.23 g/mol. Its IUPAC name is N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine.
Molecular Properties
| Compound Name | N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine |
| PubChem CID | 159889830 |
| Molecular Formula | C7H18N2O2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine |
| SMILES | CON(C)C.CON=C(C)C |
| InChI | InChI=1S/C4H9NO.C3H9NO/c1-4(2)5-6-3;1-4(2)5-3/h1-3H3;1-3H3 |
| InChIKey | NUPLTTJQABHFPR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine?
The IUPAC name of N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine (CID 159889830) is N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine.
What is the SMILES notation for N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine?
The canonical SMILES for N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine is CON(C)C.CON=C(C)C.
What is the InChIKey of N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine?
The InChIKey is NUPLTTJQABHFPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C3H9NO/c1-4(2)5-6-3;1-4(2)5-3/h1-3H3;1-3H3.
What are the key properties of N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine?
N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine has a molecular weight of 162.23 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N-methylmethanamine;N-methoxypropan-2-imine is sourced from PubChem (CID 159889830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).