About 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate
1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate (PubChem CID 159890158) has the molecular formula C17H23N3O5
and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate.
Molecular Properties
| Compound Name | 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate |
| PubChem CID | 159890158 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate |
| SMILES | COC(=O)C(=CN(C)C)C(=O)C1CC1.O=C(O)c1cnn(C2CC2)c1 |
| InChI | InChI=1S/C10H15NO3.C7H8N2O2/c1-11(2)6-8(10(13)14-3)9(12)7-4-5-7;10-7(11)5-3-8-9(4-5)6-1-2-6/h6-7H,4-5H2,1-3H3;3-4,6H,1-2H2,(H,10,11) |
| InChIKey | NUQNROFKLBOMLV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate?
The IUPAC name of 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate (CID 159890158) is 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate.
What is the SMILES notation for 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate?
The canonical SMILES for 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate is COC(=O)C(=CN(C)C)C(=O)C1CC1.O=C(O)c1cnn(C2CC2)c1.
What is the InChIKey of 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate?
The InChIKey is NUQNROFKLBOMLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3.C7H8N2O2/c1-11(2)6-8(10(13)14-3)9(12)7-4-5-7;10-7(11)5-3-8-9(4-5)6-1-2-6/h6-7H,4-5H2,1-3H3;3-4,6H,1-2H2,(H,10,11).
What are the key properties of 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate?
1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate has a molecular weight of 349.39 g/mol, XLogP of 1.50, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylpyrazole-4-carboxylic acid;methyl 2-(cyclopropanecarbonyl)-3-(dimethylamino)prop-2-enoate is sourced from PubChem (CID 159890158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).