About 1-methylpyrazin-1-ium
1-methylpyrazin-1-ium (PubChem CID 159890742) has the molecular formula C10H14N4+2
and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-methylpyrazin-1-ium.
Molecular Properties
| Compound Name | 1-methylpyrazin-1-ium |
| PubChem CID | 159890742 |
| Molecular Formula | C10H14N4+2 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-methylpyrazin-1-ium |
| SMILES | C[n+]1ccncc1.C[n+]1ccncc1 |
| InChI | InChI=1S/2C5H7N2/c2*1-7-4-2-6-3-5-7/h2*2-5H,1H3/q2*+1 |
| InChIKey | NUSIIARRKAGHCA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 33.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrazin-1-ium?
The IUPAC name of 1-methylpyrazin-1-ium (CID 159890742) is 1-methylpyrazin-1-ium.
What is the SMILES notation for 1-methylpyrazin-1-ium?
The canonical SMILES for 1-methylpyrazin-1-ium is C[n+]1ccncc1.C[n+]1ccncc1.
What is the InChIKey of 1-methylpyrazin-1-ium?
The InChIKey is NUSIIARRKAGHCA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H7N2/c2*1-7-4-2-6-3-5-7/h2*2-5H,1H3/q2*+1.
What are the key properties of 1-methylpyrazin-1-ium?
1-methylpyrazin-1-ium has a molecular weight of 190.25 g/mol, XLogP of -0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrazin-1-ium is sourced from PubChem (CID 159890742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).