C25H31ClN4O4S — CID 15989109
6-[1-[2-(butan-2-ylamino)-2-oxoethyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]-N-[(2-chlorophenyl)methyl]hexanamide (PubChem CID 15989109) has the molecular formula C25H31ClN4O4S and a molecular weight of 519.07 g/mol. Its IUPAC name is 6-[1-[2-(butan-2-ylamino)-2-oxoethyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]-N-[(2-chlorophenyl)methyl]hexanamide.
| Compound Name | 6-[1-[2-(butan-2-ylamino)-2-oxoethyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]-N-[(2-chlorophenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 15989109 |
| Molecular Formula | C25H31ClN4O4S |
| Molecular Weight | 519.07 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 6-[1-[2-(butan-2-ylamino)-2-oxoethyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]-N-[(2-chlorophenyl)methyl]hexanamide |
| SMILES | CCC(C)NC(=O)Cn1c(=O)n(CCCCCC(=O)NCc2ccccc2Cl)c(=O)c2sccc21 |
| InChI | InChI=1S/C25H31ClN4O4S/c1-3-17(2)28-22(32)16-30-20-12-14-35-23(20)24(33)29(25(30)34)13-8-4-5-11-21(31)27-15-18-9-6-7-10-19(18)26/h6-7,9-10,12,14,17H,3-5,8,11,13,15-16H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | MSBAYHIITMNUGA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.07 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|