About 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate
5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate (PubChem CID 159891492) has the molecular formula C33H46O12S
and a molecular weight of 666.79 g/mol. Its IUPAC name is 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate.
Molecular Properties
| Compound Name | 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate |
| PubChem CID | 159891492 |
| Molecular Formula | C33H46O12S |
| Molecular Weight | 666.79 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCC(=O)OCc1ccccc1)OS(C)(=O)=O.CC(C)(C)OC(=O)[C@H](O)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24O7S.C16H22O5/c1-17(2,3)23-16(19)14(24-25(4,20)21)10-11-15(18)22-12-13-8-6-5-7-9-13;1-16(2,3)21-15(19)13(17)9-10-14(18)20-11-12-7-5-4-6-8-12/h5-9,14H,10-12H2,1-4H3;4-8,13,17H,9-11H2,1-3H3/t14-;13-/m11/s1 |
| InChIKey | NUURPKUIGMIVLK-YHDDXKOVSA-N |
| XLogP | 4.41 |
| TPSA | 168.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 666.79 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate?
The IUPAC name of 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate (CID 159891492) is 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate.
What is the SMILES notation for 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate?
The canonical SMILES for 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate is CC(C)(C)OC(=O)[C@@H](CCC(=O)OCc1ccccc1)OS(C)(=O)=O.CC(C)(C)OC(=O)[C@H](O)CCC(=O)OCc1ccccc1.
What is the InChIKey of 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate?
The InChIKey is NUURPKUIGMIVLK-YHDDXKOVSA-N. The full InChI is InChI=1S/C17H24O7S.C16H22O5/c1-17(2,3)23-16(19)14(24-25(4,20)21)10-11-15(18)22-12-13-8-6-5-7-9-13;1-16(2,3)21-15(19)13(17)9-10-14(18)20-11-12-7-5-4-6-8-12/h5-9,14H,10-12H2,1-4H3;4-8,13,17H,9-11H2,1-3H3/t14-;13-/m11/s1.
What are the key properties of 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate?
5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate has a molecular weight of 666.79 g/mol, XLogP of 4.41, 14 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-benzyl 1-O-tert-butyl (2R)-2-hydroxypentanedioate;5-O-benzyl 1-O-tert-butyl (2R)-2-methylsulfonyloxypentanedioate is sourced from PubChem (CID 159891492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).