C27H34N5O8S2Se+ — CID 159892021
carbon dioxide;[7-(methylamino)-1-methylperoxy-4,7-dioxo-6-[[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]methylselanylsulfanylmethyl]heptyl]azanium (PubChem CID 159892021) has the molecular formula C27H34N5O8S2Se+ and a molecular weight of 699.69 g/mol. Its IUPAC name is carbon dioxide;[7-(methylamino)-1-methylperoxy-4,7-dioxo-6-[[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]methylselanylsulfanylmethyl]heptyl]azanium.
| Compound Name | carbon dioxide;[7-(methylamino)-1-methylperoxy-4,7-dioxo-6-[[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]methylselanylsulfanylmethyl]heptyl]azanium |
|---|---|
| PubChem CID | 159892021 |
| Molecular Formula | C27H34N5O8S2Se+ |
| Molecular Weight | 699.69 g/mol |
| Exact Mass | 700.10 |
| IUPAC Name | carbon dioxide;[7-(methylamino)-1-methylperoxy-4,7-dioxo-6-[[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]methylselanylsulfanylmethyl]heptyl]azanium |
| SMILES | CNC(=O)C(CS[Se]Cc1cc(-c2ccccc2)n(-c2ccc(S(N)(=O)=O)cc2)n1)CC(=O)CCC([NH3+])OOC.O=C=O |
| InChI | InChI=1S/C26H33N5O6S2Se.CO2/c1-29-26(33)19(14-22(32)10-13-25(27)37-36-2)16-38-40-17-20-15-24(18-6-4-3-5-7-18)31(30-20)21-8-11-23(12-9-21)39(28,34)35;2-1-3/h3-9,11-12,15,19,25H,10,13-14,16-17,27H2,1-2H3,(H,29,33)(H2,28,34,35);/p+1 |
| InChIKey | NUWHVIYXWOLGOW-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 204.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.69 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|