C28H26ClN3O5 — CID 15989206
N-(1,3-benzodioxol-5-ylmethyl)-5-[1-[(3-chlorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide (PubChem CID 15989206) has the molecular formula C28H26ClN3O5 and a molecular weight of 519.99 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-[1-[(3-chlorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-[1-[(3-chlorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide |
|---|---|
| PubChem CID | 15989206 |
| Molecular Formula | C28H26ClN3O5 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-[1-[(3-chlorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide |
| SMILES | O=C(CCCCn1c(=O)c2ccccc2n(Cc2cccc(Cl)c2)c1=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H26ClN3O5/c29-21-7-5-6-20(14-21)17-32-23-9-2-1-8-22(23)27(34)31(28(32)35)13-4-3-10-26(33)30-16-19-11-12-24-25(15-19)37-18-36-24/h1-2,5-9,11-12,14-15H,3-4,10,13,16-18H2,(H,30,33) |
| InChIKey | KCUFBLIXMIPOSJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|