C15H8F2N4 — CID 159892122
11-(2,5-di(19F)fluoro-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 159892122) has the molecular formula C15H8F2N4 and a molecular weight of 282.25 g/mol. Its IUPAC name is 11-(2,5-di(19F)fluoro-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-(2,5-di(19F)fluoro-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 159892122 |
| Molecular Formula | C15H8F2N4 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 11-(2,5-di(19F)fluoro-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | [19F]c1cnc([19F])c(-c2ccc3c(n2)[nH]c2ccncc23)c1 |
| InChI | InChI=1S/C15H8F2N4/c16-8-5-10(14(17)19-6-8)12-2-1-9-11-7-18-4-3-13(11)21-15(9)20-12/h1-7H,(H,20,21)/i16+0,17+0 |
| InChIKey | BSQWPILBECNNIW-CPRBYFLJSA-N |
| XLogP | 3.45 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|