About tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate
tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate (PubChem CID 159893297) has the molecular formula C21H25N5O4S
and a molecular weight of 443.53 g/mol. Its IUPAC name is tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate |
| PubChem CID | 159893297 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate |
| SMILES | Cc1cc2ncnc(-c3ccc(CNS(=O)(=O)NC(=O)OC(C)(C)C)nc3)c2cc1C |
| InChI | InChI=1S/C21H25N5O4S/c1-13-8-17-18(9-14(13)2)23-12-24-19(17)15-6-7-16(22-10-15)11-25-31(28,29)26-20(27)30-21(3,4)5/h6-10,12,25H,11H2,1-5H3,(H,26,27) |
| InChIKey | NVALSNFECYKQAG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate?
The IUPAC name of tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate (CID 159893297) is tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate.
What is the SMILES notation for tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate?
The canonical SMILES for tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate is Cc1cc2ncnc(-c3ccc(CNS(=O)(=O)NC(=O)OC(C)(C)C)nc3)c2cc1C.
What is the InChIKey of tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate?
The InChIKey is NVALSNFECYKQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N5O4S/c1-13-8-17-18(9-14(13)2)23-12-24-19(17)15-6-7-16(22-10-15)11-25-31(28,29)26-20(27)30-21(3,4)5/h6-10,12,25H,11H2,1-5H3,(H,26,27).
What are the key properties of tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate?
tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate has a molecular weight of 443.53 g/mol, XLogP of 3.17, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[5-(6,7-dimethylquinazolin-4-yl)-2-pyridinyl]methylsulfamoyl]carbamate is sourced from PubChem (CID 159893297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).