C29H30ClN3O3 — CID 15989357
N-[(2-chlorophenyl)methyl]-5-[1-[(2,5-dimethylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide (PubChem CID 15989357) has the molecular formula C29H30ClN3O3 and a molecular weight of 504.03 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-5-[1-[(2,5-dimethylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-5-[1-[(2,5-dimethylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide |
|---|---|
| PubChem CID | 15989357 |
| Molecular Formula | C29H30ClN3O3 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-5-[1-[(2,5-dimethylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide |
| SMILES | Cc1ccc(C)c(Cn2c(=O)n(CCCCC(=O)NCc3ccccc3Cl)c(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C29H30ClN3O3/c1-20-14-15-21(2)23(17-20)19-33-26-12-6-4-10-24(26)28(35)32(29(33)36)16-8-7-13-27(34)31-18-22-9-3-5-11-25(22)30/h3-6,9-12,14-15,17H,7-8,13,16,18-19H2,1-2H3,(H,31,34) |
| InChIKey | XZJPAEYOEUYLEZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|