C31H32FN7O4 — CID 159893658
7-[5-[3-[(4R,5R)-5-(2-fluoro-4-pyridinyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]-2-oxopropyl]-4-methyl-1-phenylpyrazol-3-yl]-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one (PubChem CID 159893658) has the molecular formula C31H32FN7O4 and a molecular weight of 585.64 g/mol. Its IUPAC name is 7-[5-[3-[(4R,5R)-5-(2-fluoro-4-pyridinyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]-2-oxopropyl]-4-methyl-1-phenylpyrazol-3-yl]-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 7-[5-[3-[(4R,5R)-5-(2-fluoro-4-pyridinyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]-2-oxopropyl]-4-methyl-1-phenylpyrazol-3-yl]-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 159893658 |
| Molecular Formula | C31H32FN7O4 |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | 7-[5-[3-[(4R,5R)-5-(2-fluoro-4-pyridinyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]-2-oxopropyl]-4-methyl-1-phenylpyrazol-3-yl]-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one |
| SMILES | COCCN1C[C@@H](CC(=O)Cc2c(C)c(-c3cnc4c(c3)NC(=O)CN4)nn2-c2ccccc2)[C@H](c2ccnc(F)c2)O1 |
| InChI | InChI=1S/C31H32FN7O4/c1-19-26(15-24(40)12-22-18-38(10-11-42-2)43-30(22)20-8-9-33-27(32)14-20)39(23-6-4-3-5-7-23)37-29(19)21-13-25-31(34-16-21)35-17-28(41)36-25/h3-9,13-14,16,22,30H,10-12,15,17-18H2,1-2H3,(H,34,35)(H,36,41)/t22-,30+/m1/s1 |
| InChIKey | NVBMUQNHGFGVCK-RCRUUEGKSA-N |
| XLogP | 3.89 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|