carbonic acid;oxalic acid;sulfuric acid

C3H6O11S — CID 159893753

IUPACcarbonic acid;oxalic acid;sulfuric acid
SMILESO=C(O)C(=O)O.O=C(O)O.O=S(=O)(O)O
InChIInChI=1S/C2H2O4.CH2O3.H2O4S/c3-1(4)2(5)6;2-1(3)4;1-5(2,3)4/h(H,3,4)(H,5,6);(H2,2,3,4);(H2,1,2,3,4)
InChIKeyNVBULFMXIVZJDF-UHFFFAOYSA-N
MW250.14 g/mol
LogP-1.27
Rot. Bonds

About carbonic acid;oxalic acid;sulfuric acid

carbonic acid;oxalic acid;sulfuric acid (PubChem CID 159893753) has the molecular formula C3H6O11S and a molecular weight of 250.14 g/mol. Its IUPAC name is carbonic acid;oxalic acid;sulfuric acid.

Molecular Properties

Compound Namecarbonic acid;oxalic acid;sulfuric acid
PubChem CID159893753
Molecular FormulaC3H6O11S
Molecular Weight250.14 g/mol
Exact Mass249.96
IUPAC Namecarbonic acid;oxalic acid;sulfuric acid
SMILESO=C(O)C(=O)O.O=C(O)O.O=S(=O)(O)O
InChIInChI=1S/C2H2O4.CH2O3.H2O4S/c3-1(4)2(5)6;2-1(3)4;1-5(2,3)4/h(H,3,4)(H,5,6);(H2,2,3,4);(H2,1,2,3,4)
InChIKeyNVBULFMXIVZJDF-UHFFFAOYSA-N
XLogP-1.27
TPSA206.73 Ų
H-Bond Donors6
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500250.14
LogP ≤ 5-1.27
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze carbonic acid;oxalic acid;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

strontium;hydride;oxalic acid;sulfuric acid
CID 173409846
dilithium;carbonic acid;hydride;sulfuric acid
CID 173345515
calcium;sodium;carbonic acid;hydride;sulfuric acid
CID 174433477
tricalcium;carbonic acid;hydride;methane;sulfuric acid
CID 173457903
sodium;carbonic acid;hydride;silver;sulfuric acid
CID 173401704
azane;carbonic acid;oxalic acid
CID 174837249
lithium;oxalic acid;chloride
CID 175547992
acetic acid;sulfuric acid
CID 172861121
acetic acid;sulfuric acid
CID 158118264
acetic acid;sulfuric acid
CID 157312003
sodium;hydrogen sulfate;iron;oxalic acid
CID 171782917
sodium;hydride;hydrogen peroxide;sulfuric acid
CID 173021653

Frequently Asked Questions

What is the IUPAC name of carbonic acid;oxalic acid;sulfuric acid?
The IUPAC name of carbonic acid;oxalic acid;sulfuric acid (CID 159893753) is carbonic acid;oxalic acid;sulfuric acid.
What is the SMILES notation for carbonic acid;oxalic acid;sulfuric acid?
The canonical SMILES for carbonic acid;oxalic acid;sulfuric acid is O=C(O)C(=O)O.O=C(O)O.O=S(=O)(O)O.
What is the InChIKey of carbonic acid;oxalic acid;sulfuric acid?
The InChIKey is NVBULFMXIVZJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O4.CH2O3.H2O4S/c3-1(4)2(5)6;2-1(3)4;1-5(2,3)4/h(H,3,4)(H,5,6);(H2,2,3,4);(H2,1,2,3,4).
What are the key properties of carbonic acid;oxalic acid;sulfuric acid?
carbonic acid;oxalic acid;sulfuric acid has a molecular weight of 250.14 g/mol, XLogP of -1.27, 0 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;oxalic acid;sulfuric acid is sourced from PubChem (CID 159893753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).