C30H32N4O5 — CID 15989407
5-[1-[2-(3-methoxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(2-phenylethyl)pentanamide (PubChem CID 15989407) has the molecular formula C30H32N4O5 and a molecular weight of 528.61 g/mol. Its IUPAC name is 5-[1-[2-(3-methoxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(2-phenylethyl)pentanamide.
| Compound Name | 5-[1-[2-(3-methoxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(2-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 15989407 |
| Molecular Formula | C30H32N4O5 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 5-[1-[2-(3-methoxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(2-phenylethyl)pentanamide |
| SMILES | COc1cccc(NC(=O)Cn2c(=O)n(CCCCC(=O)NCCc3ccccc3)c(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C30H32N4O5/c1-39-24-13-9-12-23(20-24)32-28(36)21-34-26-15-6-5-14-25(26)29(37)33(30(34)38)19-8-7-16-27(35)31-18-17-22-10-3-2-4-11-22/h2-6,9-15,20H,7-8,16-19,21H2,1H3,(H,31,35)(H,32,36) |
| InChIKey | VVOLGJRLCKUPJK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|