C26H25N3O5 — CID 15989492
2-[6,7-dimethoxy-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]-N-phenylacetamide (PubChem CID 15989492) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-[6,7-dimethoxy-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[6,7-dimethoxy-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 15989492 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-[6,7-dimethoxy-2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]-N-phenylacetamide |
| SMILES | COc1cc2c(=O)n(CCc3ccccc3)c(=O)n(CC(=O)Nc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C26H25N3O5/c1-33-22-15-20-21(16-23(22)34-2)29(17-24(30)27-19-11-7-4-8-12-19)26(32)28(25(20)31)14-13-18-9-5-3-6-10-18/h3-12,15-16H,13-14,17H2,1-2H3,(H,27,30) |
| InChIKey | XMSGPLRNWJINNK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |