C8H20F3NSi2 — CID 159895269
2,2,2-trifluoro-N,N-bis(trimethylsilyl)ethanamine (PubChem CID 159895269) has the molecular formula C8H20F3NSi2 and a molecular weight of 243.42 g/mol. Its IUPAC name is 2,2,2-trifluoro-N,N-bis(trimethylsilyl)ethanamine.
| Compound Name | 2,2,2-trifluoro-N,N-bis(trimethylsilyl)ethanamine |
|---|---|
| PubChem CID | 159895269 |
| Molecular Formula | C8H20F3NSi2 |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2,2,2-trifluoro-N,N-bis(trimethylsilyl)ethanamine |
| SMILES | C[Si](C)(C)N(CC(F)(F)F)[Si](C)(C)C |
| InChI | InChI=1S/C8H20F3NSi2/c1-13(2,3)12(14(4,5)6)7-8(9,10)11/h7H2,1-6H3 |
| InChIKey | NVGKZBNIKCZBID-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|