C42H48N8O8 — CID 159895341
2-methoxyethyl 2-[3-[1-[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]ethyl]phenyl]acetate (PubChem CID 159895341) has the molecular formula C42H48N8O8 and a molecular weight of 792.89 g/mol. Its IUPAC name is 2-methoxyethyl 2-[3-[1-[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]ethyl]phenyl]acetate.
| Compound Name | 2-methoxyethyl 2-[3-[1-[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]ethyl]phenyl]acetate |
|---|---|
| PubChem CID | 159895341 |
| Molecular Formula | C42H48N8O8 |
| Molecular Weight | 792.89 g/mol |
| Exact Mass | 792.36 |
| IUPAC Name | 2-methoxyethyl 2-[3-[1-[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]ethyl]phenyl]acetate |
| SMILES | COCCOC(=O)Cc1cccc(C(C)c2nn(-c3cnn(C)c3)ccc2=O)c1.COCCOC(=O)Cc1cccc(C(C)c2nn(-c3cnn(C)c3)ccc2=O)c1 |
| InChI | InChI=1S/2C21H24N4O4/c2*1-15(17-6-4-5-16(11-17)12-20(27)29-10-9-28-3)21-19(26)7-8-25(23-21)18-13-22-24(2)14-18/h2*4-8,11,13-15H,9-10,12H2,1-3H3 |
| InChIKey | NVGRGZHKKSVALL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 176.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.89 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|