About N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide
N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide (PubChem CID 15989583) has the molecular formula C20H26N2O5S2
and a molecular weight of 438.57 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide |
| PubChem CID | 15989583 |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCC(CNS(=O)(=O)c3cccs3)CC2)cc1OC |
| InChI | InChI=1S/C20H26N2O5S2/c1-26-17-10-9-16(12-18(17)27-2)22-20(23)15-7-5-14(6-8-15)13-21-29(24,25)19-4-3-11-28-19/h3-4,9-12,14-15,21H,5-8,13H2,1-2H3,(H,22,23) |
| InChIKey | GXPRANQRHPVWBL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide?
The IUPAC name of N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide (CID 15989583) is N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide.
What is the SMILES notation for N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide?
The canonical SMILES for N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide is COc1ccc(NC(=O)C2CCC(CNS(=O)(=O)c3cccs3)CC2)cc1OC.
What is the InChIKey of N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide?
The InChIKey is GXPRANQRHPVWBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O5S2/c1-26-17-10-9-16(12-18(17)27-2)22-20(23)15-7-5-14(6-8-15)13-21-29(24,25)19-4-3-11-28-19/h3-4,9-12,14-15,21H,5-8,13H2,1-2H3,(H,22,23).
What are the key properties of N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide?
N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide has a molecular weight of 438.57 g/mol, XLogP of 3.49, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethoxyphenyl)-4-[(thiophen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxamide is sourced from PubChem (CID 15989583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).