C20H24Cl2N4O — CID 15989688
1-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-3-(4-chlorophenyl)urea (PubChem CID 15989688) has the molecular formula C20H24Cl2N4O and a molecular weight of 407.35 g/mol. Its IUPAC name is 1-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 15989688 |
| Molecular Formula | C20H24Cl2N4O |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]ethyl]-3-(4-chlorophenyl)urea |
| SMILES | Cc1ccc(Cl)cc1N1CCN(CCNC(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H24Cl2N4O/c1-15-2-3-17(22)14-19(15)26-12-10-25(11-13-26)9-8-23-20(27)24-18-6-4-16(21)5-7-18/h2-7,14H,8-13H2,1H3,(H2,23,24,27) |
| InChIKey | PRVAUHQBSBMJCR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |