About 3-ethylpyrrole-2,5-dione;hydrazine
3-ethylpyrrole-2,5-dione;hydrazine (PubChem CID 159897109) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is 3-ethylpyrrole-2,5-dione;hydrazine.
Molecular Properties
| Compound Name | 3-ethylpyrrole-2,5-dione;hydrazine |
| PubChem CID | 159897109 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3-ethylpyrrole-2,5-dione;hydrazine |
| SMILES | CCC1=CC(=O)NC1=O.NN |
| InChI | InChI=1S/C6H7NO2.H4N2/c1-2-4-3-5(8)7-6(4)9;1-2/h3H,2H2,1H3,(H,7,8,9);1-2H2 |
| InChIKey | NVMDOHOUIGQPOL-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylpyrrole-2,5-dione;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylpyrrole-2,5-dione;hydrazine?
The IUPAC name of 3-ethylpyrrole-2,5-dione;hydrazine (CID 159897109) is 3-ethylpyrrole-2,5-dione;hydrazine.
What is the SMILES notation for 3-ethylpyrrole-2,5-dione;hydrazine?
The canonical SMILES for 3-ethylpyrrole-2,5-dione;hydrazine is CCC1=CC(=O)NC1=O.NN.
What is the InChIKey of 3-ethylpyrrole-2,5-dione;hydrazine?
The InChIKey is NVMDOHOUIGQPOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.H4N2/c1-2-4-3-5(8)7-6(4)9;1-2/h3H,2H2,1H3,(H,7,8,9);1-2H2.
What are the key properties of 3-ethylpyrrole-2,5-dione;hydrazine?
3-ethylpyrrole-2,5-dione;hydrazine has a molecular weight of 157.17 g/mol, XLogP of -1.20, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpyrrole-2,5-dione;hydrazine is sourced from PubChem (CID 159897109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).