C16H29N3O7 — CID 159898040
tert-butyl N-[(3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-yl]carbamate;trimethoxymethane (PubChem CID 159898040) has the molecular formula C16H29N3O7 and a molecular weight of 375.42 g/mol. Its IUPAC name is tert-butyl N-[(3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-yl]carbamate;trimethoxymethane.
| Compound Name | tert-butyl N-[(3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-yl]carbamate;trimethoxymethane |
|---|---|
| PubChem CID | 159898040 |
| Molecular Formula | C16H29N3O7 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | tert-butyl N-[(3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-yl]carbamate;trimethoxymethane |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](c2ncon2)OC1.COC(OC)OC |
| InChI | InChI=1S/C12H19N3O4.C4H10O3/c1-12(2,3)19-11(16)14-8-4-5-9(17-6-8)10-13-7-18-15-10;1-5-4(6-2)7-3/h7-9H,4-6H2,1-3H3,(H,14,16);4H,1-3H3/t8-,9+;/m1./s1 |
| InChIKey | NVPDZQKQQUTFFF-RJUBDTSPSA-N |
| XLogP | 2.02 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|