About 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid
3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid (PubChem CID 15989806) has the molecular formula C21H19N5O2
and a molecular weight of 373.42 g/mol. Its IUPAC name is 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid |
| PubChem CID | 15989806 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid |
| SMILES | Cc1cc(C)n(-c2nc3ccccc3nc2Nc2cc(C(=O)O)ccc2C)n1 |
| InChI | InChI=1S/C21H19N5O2/c1-12-8-9-15(21(27)28)11-18(12)23-19-20(26-14(3)10-13(2)25-26)24-17-7-5-4-6-16(17)22-19/h4-11H,1-3H3,(H,22,23)(H,27,28) |
| InChIKey | LQBPMIKMXMLOOL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid?
The IUPAC name of 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid (CID 15989806) is 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid.
What is the SMILES notation for 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid?
The canonical SMILES for 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid is Cc1cc(C)n(-c2nc3ccccc3nc2Nc2cc(C(=O)O)ccc2C)n1.
What is the InChIKey of 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid?
The InChIKey is LQBPMIKMXMLOOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N5O2/c1-12-8-9-15(21(27)28)11-18(12)23-19-20(26-14(3)10-13(2)25-26)24-17-7-5-4-6-16(17)22-19/h4-11H,1-3H3,(H,22,23)(H,27,28).
What are the key properties of 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid?
3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid has a molecular weight of 373.42 g/mol, XLogP of 4.18, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]-4-methylbenzoic acid is sourced from PubChem (CID 15989806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).