About 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine
3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine (PubChem CID 15989807) has the molecular formula C22H23N5
and a molecular weight of 357.46 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine.
Molecular Properties
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine |
| PubChem CID | 15989807 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine |
| SMILES | Cc1cc(C)n(-c2nc3ccccc3nc2Nc2ccc(C(C)C)cc2)n1 |
| InChI | InChI=1S/C22H23N5/c1-14(2)17-9-11-18(12-10-17)23-21-22(27-16(4)13-15(3)26-27)25-20-8-6-5-7-19(20)24-21/h5-14H,1-4H3,(H,23,24) |
| InChIKey | SFXCCZCSEHVEQV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine?
The IUPAC name of 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine (CID 15989807) is 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine.
What is the SMILES notation for 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine?
The canonical SMILES for 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine is Cc1cc(C)n(-c2nc3ccccc3nc2Nc2ccc(C(C)C)cc2)n1.
What is the InChIKey of 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine?
The InChIKey is SFXCCZCSEHVEQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5/c1-14(2)17-9-11-18(12-10-17)23-21-22(27-16(4)13-15(3)26-27)25-20-8-6-5-7-19(20)24-21/h5-14H,1-4H3,(H,23,24).
What are the key properties of 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine?
3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine has a molecular weight of 357.46 g/mol, XLogP of 5.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylpyrazol-1-yl)-N-(4-propan-2-ylphenyl)quinoxalin-2-amine is sourced from PubChem (CID 15989807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).