C9H21NO4 — CID 159898844
methane;4-(2-methoxyethoxy)-2-oxobutanamide (PubChem CID 159898844) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is methane;4-(2-methoxyethoxy)-2-oxobutanamide.
| Compound Name | methane;4-(2-methoxyethoxy)-2-oxobutanamide |
|---|---|
| PubChem CID | 159898844 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | methane;4-(2-methoxyethoxy)-2-oxobutanamide |
| SMILES | C.C.COCCOCCC(=O)C(N)=O |
| InChI | InChI=1S/C7H13NO4.2CH4/c1-11-4-5-12-3-2-6(9)7(8)10;;/h2-5H2,1H3,(H2,8,10);2*1H4 |
| InChIKey | NVRPPSZIOYRJEL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|