About methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine
methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine (PubChem CID 159899585) has the molecular formula C10H26N2
and a molecular weight of 174.33 g/mol. Its IUPAC name is methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine.
Molecular Properties
| Compound Name | methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine |
| PubChem CID | 159899585 |
| Molecular Formula | C10H26N2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.21 |
| IUPAC Name | methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine |
| SMILES | C.C.C=C(C)CN(C)CN(C)C |
| InChI | InChI=1S/C8H18N2.2CH4/c1-8(2)6-10(5)7-9(3)4;;/h1,6-7H2,2-5H3;2*1H4 |
| InChIKey | NVTZGYQIXWHTGI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine?
The IUPAC name of methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine (CID 159899585) is methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine.
What is the SMILES notation for methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine?
The canonical SMILES for methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine is C.C.C=C(C)CN(C)CN(C)C.
What is the InChIKey of methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine?
The InChIKey is NVTZGYQIXWHTGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.2CH4/c1-8(2)6-10(5)7-9(3)4;;/h1,6-7H2,2-5H3;2*1H4.
What are the key properties of methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine?
methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine has a molecular weight of 174.33 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N,N,N'-trimethyl-N'-(2-methylprop-2-enyl)methanediamine is sourced from PubChem (CID 159899585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).