About 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid
5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid (PubChem CID 15989960) has the molecular formula C20H19ClN2O3
and a molecular weight of 370.84 g/mol. Its IUPAC name is 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid |
| PubChem CID | 15989960 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccc(C)c(N(C)C(=O)Cc2c(C(=O)O)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C20H19ClN2O3/c1-11-4-5-12(2)17(8-11)23(3)18(24)10-15-14-9-13(21)6-7-16(14)22-19(15)20(25)26/h4-9,22H,10H2,1-3H3,(H,25,26) |
| InChIKey | ZHDSIZIKSAEKSK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid?
The IUPAC name of 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid (CID 15989960) is 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid.
What is the SMILES notation for 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid?
The canonical SMILES for 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid is Cc1ccc(C)c(N(C)C(=O)Cc2c(C(=O)O)[nH]c3ccc(Cl)cc23)c1.
What is the InChIKey of 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid?
The InChIKey is ZHDSIZIKSAEKSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN2O3/c1-11-4-5-12(2)17(8-11)23(3)18(24)10-15-14-9-13(21)6-7-16(14)22-19(15)20(25)26/h4-9,22H,10H2,1-3H3,(H,25,26).
What are the key properties of 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid?
5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid has a molecular weight of 370.84 g/mol, XLogP of 4.34, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[2-oxo-2-(N,2,5-trimethylanilino)ethyl]-1H-indole-2-carboxylic acid is sourced from PubChem (CID 15989960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).